C12H19F3N4O — CID 80845851
6-N-methyl-5-propan-2-yl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine (PubChem CID 80845851) has the molecular formula C12H19F3N4O and a molecular weight of 292.31 g/mol. Its IUPAC name is 6-N-methyl-5-propan-2-yl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-methyl-5-propan-2-yl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80845851 |
| Molecular Formula | C12H19F3N4O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 6-N-methyl-5-propan-2-yl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(NCCOCC(F)(F)F)c1C(C)C |
| InChI | InChI=1S/C12H19F3N4O/c1-8(2)9-10(16-3)18-7-19-11(9)17-4-5-20-6-12(13,14)15/h7-8H,4-6H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | LBZIRMXBAAHMTJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|