C14H19N5O2 — CID 80846373
4-ethoxy-N-ethyl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine (PubChem CID 80846373) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-N-ethyl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80846373 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 4-ethoxy-N-ethyl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(OCC)nc(OCCc2ccccn2)n1 |
| InChI | InChI=1S/C14H19N5O2/c1-3-15-12-17-13(20-4-2)19-14(18-12)21-10-8-11-7-5-6-9-16-11/h5-7,9H,3-4,8,10H2,1-2H3,(H,15,17,18,19) |
| InChIKey | CJFRVXDRBVQUAI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |