C10H15F3N4O — CID 80846404
6-N,2-dimethyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine (PubChem CID 80846404) has the molecular formula C10H15F3N4O and a molecular weight of 264.25 g/mol. Its IUPAC name is 6-N,2-dimethyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N,2-dimethyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80846404 |
| Molecular Formula | C10H15F3N4O |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-N,2-dimethyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,6-diamine |
| SMILES | CNc1cc(NCCOCC(F)(F)F)nc(C)n1 |
| InChI | InChI=1S/C10H15F3N4O/c1-7-16-8(14-2)5-9(17-7)15-3-4-18-6-10(11,12)13/h5H,3-4,6H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | IGTDXDIPWDGCNL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|