C9H12F4N4O — CID 80846653
5-fluoro-2-N-methyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-diamine (PubChem CID 80846653) has the molecular formula C9H12F4N4O and a molecular weight of 268.21 g/mol. Its IUPAC name is 5-fluoro-2-N-methyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-methyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80846653 |
| Molecular Formula | C9H12F4N4O |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 5-fluoro-2-N-methyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-diamine |
| SMILES | CNc1ncc(F)c(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F4N4O/c1-14-8-16-4-6(10)7(17-8)15-2-3-18-5-9(11,12)13/h4H,2-3,5H2,1H3,(H2,14,15,16,17) |
| InChIKey | OKQYLSMTQJNVOD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|