C11H14ClF3N4 — CID 80847602
5-chloro-N-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-2-amine (PubChem CID 80847602) has the molecular formula C11H14ClF3N4 and a molecular weight of 294.71 g/mol. Its IUPAC name is 5-chloro-N-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 80847602 |
| Molecular Formula | C11H14ClF3N4 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 5-chloro-N-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-2-amine |
| SMILES | CNc1ncc(Cl)c(N2CCC(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C11H14ClF3N4/c1-16-10-17-6-8(12)9(18-10)19-4-2-7(3-5-19)11(13,14)15/h6-7H,2-5H2,1H3,(H,16,17,18) |
| InChIKey | LPTGOCDAIGCXFD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |