About 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol
1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol (PubChem CID 80850675) has the molecular formula C13H23FN4O
and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol |
| PubChem CID | 80850675 |
| Molecular Formula | C13H23FN4O |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol |
| SMILES | CCNc1ncc(F)c(NCC(C)(O)CC(C)C)n1 |
| InChI | InChI=1S/C13H23FN4O/c1-5-15-12-16-7-10(14)11(18-12)17-8-13(4,19)6-9(2)3/h7,9,19H,5-6,8H2,1-4H3,(H2,15,16,17,18) |
| InChIKey | PODGANCVUXAUSJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol?
The IUPAC name of 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol (CID 80850675) is 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol.
What is the SMILES notation for 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol?
The canonical SMILES for 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol is CCNc1ncc(F)c(NCC(C)(O)CC(C)C)n1.
What is the InChIKey of 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol?
The InChIKey is PODGANCVUXAUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23FN4O/c1-5-15-12-16-7-10(14)11(18-12)17-8-13(4,19)6-9(2)3/h7,9,19H,5-6,8H2,1-4H3,(H2,15,16,17,18).
What are the key properties of 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol?
1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol has a molecular weight of 270.35 g/mol, XLogP of 2.26, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 80850675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).