C9H14N4O4 — CID 80850691
3-[(6-amino-3-nitro-2-pyridinyl)amino]-2-methylpropane-1,2-diol (PubChem CID 80850691) has the molecular formula C9H14N4O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-[(6-amino-3-nitro-2-pyridinyl)amino]-2-methylpropane-1,2-diol.
| Compound Name | 3-[(6-amino-3-nitro-2-pyridinyl)amino]-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 80850691 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-[(6-amino-3-nitro-2-pyridinyl)amino]-2-methylpropane-1,2-diol |
| SMILES | CC(O)(CO)CNc1nc(N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H14N4O4/c1-9(15,5-14)4-11-8-6(13(16)17)2-3-7(10)12-8/h2-3,14-15H,4-5H2,1H3,(H3,10,11,12) |
| InChIKey | SQCZWXLJVDCNOY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|