C12H17N5O2 — CID 80851385
3,3-dimethyl-4-[6-methyl-2-(methylamino)pyrimidin-4-yl]piperazine-2,6-dione (PubChem CID 80851385) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3,3-dimethyl-4-[6-methyl-2-(methylamino)pyrimidin-4-yl]piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-[6-methyl-2-(methylamino)pyrimidin-4-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 80851385 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3,3-dimethyl-4-[6-methyl-2-(methylamino)pyrimidin-4-yl]piperazine-2,6-dione |
| SMILES | CNc1nc(C)cc(N2CC(=O)NC(=O)C2(C)C)n1 |
| InChI | InChI=1S/C12H17N5O2/c1-7-5-8(15-11(13-4)14-7)17-6-9(18)16-10(19)12(17,2)3/h5H,6H2,1-4H3,(H,13,14,15)(H,16,18,19) |
| InChIKey | OEJMUHXNCWQZHN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|