About 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol
3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol (PubChem CID 80851413) has the molecular formula C9H15ClN4O2
and a molecular weight of 246.70 g/mol. Its IUPAC name is 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol.
Molecular Properties
| Compound Name | 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol |
| PubChem CID | 80851413 |
| Molecular Formula | C9H15ClN4O2 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol |
| SMILES | CNc1ncc(Cl)c(NCC(C)(O)CO)n1 |
| InChI | InChI=1S/C9H15ClN4O2/c1-9(16,5-15)4-13-7-6(10)3-12-8(11-2)14-7/h3,15-16H,4-5H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | KTVGDOOQKAHESH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol?
The IUPAC name of 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol (CID 80851413) is 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol.
What is the SMILES notation for 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol?
The canonical SMILES for 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol is CNc1ncc(Cl)c(NCC(C)(O)CO)n1.
What is the InChIKey of 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol?
The InChIKey is KTVGDOOQKAHESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN4O2/c1-9(16,5-15)4-13-7-6(10)3-12-8(11-2)14-7/h3,15-16H,4-5H2,1-2H3,(H2,11,12,13,14).
What are the key properties of 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol?
3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol has a molecular weight of 246.70 g/mol, XLogP of 0.33, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropane-1,2-diol is sourced from PubChem (CID 80851413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).