About 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine
4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80853154) has the molecular formula C10H14N6O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine |
| PubChem CID | 80853154 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(NC)nc(-n2ccnc2C)n1 |
| InChI | InChI=1S/C10H14N6O/c1-4-17-10-14-8(11-3)13-9(15-10)16-6-5-12-7(16)2/h5-6H,4H2,1-3H3,(H,11,13,14,15) |
| InChIKey | IDXJUWVZOLJUMT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine?
The IUPAC name of 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine (CID 80853154) is 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine?
The canonical SMILES for 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine is CCOc1nc(NC)nc(-n2ccnc2C)n1.
What is the InChIKey of 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine?
The InChIKey is IDXJUWVZOLJUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O/c1-4-17-10-14-8(11-3)13-9(15-10)16-6-5-12-7(16)2/h5-6H,4H2,1-3H3,(H,11,13,14,15).
What are the key properties of 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine?
4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine has a molecular weight of 234.26 g/mol, XLogP of 0.81, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N-methyl-6-(2-methylimidazol-1-yl)-1,3,5-triazin-2-amine is sourced from PubChem (CID 80853154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).