C9H13N5O3 — CID 80853472
6-N-methyl-5-nitro-4-N-(oxolan-3-yl)pyrimidine-4,6-diamine (PubChem CID 80853472) has the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 6-N-methyl-5-nitro-4-N-(oxolan-3-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-methyl-5-nitro-4-N-(oxolan-3-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80853472 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 6-N-methyl-5-nitro-4-N-(oxolan-3-yl)pyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(NC2CCOC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N5O3/c1-10-8-7(14(15)16)9(12-5-11-8)13-6-2-3-17-4-6/h5-6H,2-4H2,1H3,(H2,10,11,12,13) |
| InChIKey | OGLFTFXDSKZTBH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|