About 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine
6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine (PubChem CID 80853780) has the molecular formula C14H15N5
and a molecular weight of 253.31 g/mol. Its IUPAC name is 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine |
| PubChem CID | 80853780 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(-n2cnc3cc(C)c(C)cc32)ncn1 |
| InChI | InChI=1S/C14H15N5/c1-9-4-11-12(5-10(9)2)19(8-18-11)14-6-13(15-3)16-7-17-14/h4-8H,1-3H3,(H,15,16,17) |
| InChIKey | YURMTVWTBXZCFG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine?
The IUPAC name of 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine (CID 80853780) is 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine.
What is the SMILES notation for 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine?
The canonical SMILES for 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine is CNc1cc(-n2cnc3cc(C)c(C)cc32)ncn1.
What is the InChIKey of 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine?
The InChIKey is YURMTVWTBXZCFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5/c1-9-4-11-12(5-10(9)2)19(8-18-11)14-6-13(15-3)16-7-17-14/h4-8H,1-3H3,(H,15,16,17).
What are the key properties of 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine?
6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine has a molecular weight of 253.31 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5,6-dimethylbenzimidazol-1-yl)-N-methylpyrimidin-4-amine is sourced from PubChem (CID 80853780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).