About (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione
(4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione (PubChem CID 808553) has the molecular formula C15H12FNOS2
and a molecular weight of 305.40 g/mol. Its IUPAC name is (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione.
Molecular Properties
| Compound Name | (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione |
| PubChem CID | 808553 |
| Molecular Formula | C15H12FNOS2 |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione |
| SMILES | C=C[C@@H]1NC(=S)O[C@]1(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C15H12FNOS2/c1-2-12-15(18-14(19)17-12,13-4-3-9-20-13)10-5-7-11(16)8-6-10/h2-9,12H,1H2,(H,17,19)/t12-,15-/m0/s1 |
| InChIKey | YNFATFAKAQMZKE-WFASDCNBSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione?
The IUPAC name of (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione (CID 808553) is (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione.
What is the SMILES notation for (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione?
The canonical SMILES for (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione is C=C[C@@H]1NC(=S)O[C@]1(c1ccc(F)cc1)c1cccs1.
What is the InChIKey of (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione?
The InChIKey is YNFATFAKAQMZKE-WFASDCNBSA-N. The full InChI is InChI=1S/C15H12FNOS2/c1-2-12-15(18-14(19)17-12,13-4-3-9-20-13)10-5-7-11(16)8-6-10/h2-9,12H,1H2,(H,17,19)/t12-,15-/m0/s1.
What are the key properties of (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione?
(4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione has a molecular weight of 305.40 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4-ethenyl-5-(4-fluorophenyl)-5-thiophen-2-yl-1,3-oxazolidine-2-thione is sourced from PubChem (CID 808553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).