About 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione
3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione (PubChem CID 80855840) has the molecular formula C12H18N6O2
and a molecular weight of 278.32 g/mol. Its IUPAC name is 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione.
Molecular Properties
| Compound Name | 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione |
| PubChem CID | 80855840 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione |
| SMILES | CCCNc1cc(NC2CCC(=O)NC2=O)nc(N)n1 |
| InChI | InChI=1S/C12H18N6O2/c1-2-5-14-8-6-9(17-12(13)16-8)15-7-3-4-10(19)18-11(7)20/h6-7H,2-5H2,1H3,(H,18,19,20)(H4,13,14,15,16,17) |
| InChIKey | VYWVCJPFAHJOJW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione?
The IUPAC name of 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione (CID 80855840) is 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione.
What is the SMILES notation for 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione?
The canonical SMILES for 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione is CCCNc1cc(NC2CCC(=O)NC2=O)nc(N)n1.
What is the InChIKey of 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione?
The InChIKey is VYWVCJPFAHJOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N6O2/c1-2-5-14-8-6-9(17-12(13)16-8)15-7-3-4-10(19)18-11(7)20/h6-7H,2-5H2,1H3,(H,18,19,20)(H4,13,14,15,16,17).
What are the key properties of 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione?
3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione has a molecular weight of 278.32 g/mol, XLogP of 0.10, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione is sourced from PubChem (CID 80855840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).