About 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione
4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione (PubChem CID 80856356) has the molecular formula C10H13N5O2
and a molecular weight of 235.25 g/mol. Its IUPAC name is 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione.
Molecular Properties
| Compound Name | 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione |
| PubChem CID | 80856356 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione |
| SMILES | Cc1nc(N)c(C)c(N2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C10H13N5O2/c1-5-9(11)12-6(2)13-10(5)15-3-7(16)14-8(17)4-15/h3-4H2,1-2H3,(H2,11,12,13)(H,14,16,17) |
| InChIKey | ADKYCOOXWGZSTJ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione?
The IUPAC name of 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione (CID 80856356) is 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione.
What is the SMILES notation for 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione?
The canonical SMILES for 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione is Cc1nc(N)c(C)c(N2CC(=O)NC(=O)C2)n1.
What is the InChIKey of 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione?
The InChIKey is ADKYCOOXWGZSTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O2/c1-5-9(11)12-6(2)13-10(5)15-3-7(16)14-8(17)4-15/h3-4H2,1-2H3,(H2,11,12,13)(H,14,16,17).
What are the key properties of 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione?
4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione has a molecular weight of 235.25 g/mol, XLogP of -0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-amino-2,5-dimethylpyrimidin-4-yl)piperazine-2,6-dione is sourced from PubChem (CID 80856356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).