About 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine
4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine (PubChem CID 80856713) has the molecular formula C12H15ClFN5
and a molecular weight of 283.74 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine |
| PubChem CID | 80856713 |
| Molecular Formula | C12H15ClFN5 |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(F)c(-n2nc(C)c(Cl)c2C)n1 |
| InChI | InChI=1S/C12H15ClFN5/c1-4-5-15-12-16-6-9(14)11(17-12)19-8(3)10(13)7(2)18-19/h6H,4-5H2,1-3H3,(H,15,16,17) |
| InChIKey | LMFGJDFJFWNHOC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine?
The IUPAC name of 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine (CID 80856713) is 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine.
What is the SMILES notation for 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine?
The canonical SMILES for 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine is CCCNc1ncc(F)c(-n2nc(C)c(Cl)c2C)n1.
What is the InChIKey of 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine?
The InChIKey is LMFGJDFJFWNHOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClFN5/c1-4-5-15-12-16-6-9(14)11(17-12)19-8(3)10(13)7(2)18-19/h6H,4-5H2,1-3H3,(H,15,16,17).
What are the key properties of 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine?
4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine has a molecular weight of 283.74 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-5-fluoro-N-propylpyrimidin-2-amine is sourced from PubChem (CID 80856713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).