C13H16N4O2 — CID 80857632
3-(4,5-dimethylimidazol-1-yl)-N-ethyl-5-nitroaniline (PubChem CID 80857632) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-(4,5-dimethylimidazol-1-yl)-N-ethyl-5-nitroaniline.
| Compound Name | 3-(4,5-dimethylimidazol-1-yl)-N-ethyl-5-nitroaniline |
|---|---|
| PubChem CID | 80857632 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-(4,5-dimethylimidazol-1-yl)-N-ethyl-5-nitroaniline |
| SMILES | CCNc1cc(-n2cnc(C)c2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N4O2/c1-4-14-11-5-12(7-13(6-11)17(18)19)16-8-15-9(2)10(16)3/h5-8,14H,4H2,1-3H3 |
| InChIKey | IJRZGJJFACQQKC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|