About 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine
5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine (PubChem CID 80857856) has the molecular formula C13H18FN5
and a molecular weight of 263.32 g/mol. Its IUPAC name is 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine |
| PubChem CID | 80857856 |
| Molecular Formula | C13H18FN5 |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine |
| SMILES | CCCNc1ncc(F)c(-n2nc(C)c(C)c2C)n1 |
| InChI | InChI=1S/C13H18FN5/c1-5-6-15-13-16-7-11(14)12(17-13)19-10(4)8(2)9(3)18-19/h7H,5-6H2,1-4H3,(H,15,16,17) |
| InChIKey | XVLHNCAXMWRAQG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine?
The IUPAC name of 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine (CID 80857856) is 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine.
What is the SMILES notation for 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine?
The canonical SMILES for 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine is CCCNc1ncc(F)c(-n2nc(C)c(C)c2C)n1.
What is the InChIKey of 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine?
The InChIKey is XVLHNCAXMWRAQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN5/c1-5-6-15-13-16-7-11(14)12(17-13)19-10(4)8(2)9(3)18-19/h7H,5-6H2,1-4H3,(H,15,16,17).
What are the key properties of 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine?
5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine has a molecular weight of 263.32 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-propyl-4-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-2-amine is sourced from PubChem (CID 80857856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).