C10H14F3N3O — CID 80858472
N,5-diethyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine (PubChem CID 80858472) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is N,5-diethyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine.
| Compound Name | N,5-diethyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80858472 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N,5-diethyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine |
| SMILES | CCNc1ncnc(OCC(F)(F)F)c1CC |
| InChI | InChI=1S/C10H14F3N3O/c1-3-7-8(14-4-2)15-6-16-9(7)17-5-10(11,12)13/h6H,3-5H2,1-2H3,(H,14,15,16) |
| InChIKey | FHOPCELACQABPS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |