C8H10F3N3O — CID 80858915
2,5-dimethyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine (PubChem CID 80858915) has the molecular formula C8H10F3N3O and a molecular weight of 221.18 g/mol. Its IUPAC name is 2,5-dimethyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine.
| Compound Name | 2,5-dimethyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80858915 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2,5-dimethyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine |
| SMILES | Cc1nc(N)c(C)c(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3N3O/c1-4-6(12)13-5(2)14-7(4)15-3-8(9,10)11/h3H2,1-2H3,(H2,12,13,14) |
| InChIKey | PWXPWHDQXHLVEB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |