About 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol
2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol (PubChem CID 80859663) has the molecular formula C6H10N4O3
and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol.
Molecular Properties
| Compound Name | 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol |
| PubChem CID | 80859663 |
| Molecular Formula | C6H10N4O3 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol |
| SMILES | COc1nc(N)nc(OCCO)n1 |
| InChI | InChI=1S/C6H10N4O3/c1-12-5-8-4(7)9-6(10-5)13-3-2-11/h11H,2-3H2,1H3,(H2,7,8,9,10) |
| InChIKey | UOBQBEGMSORZRL-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 103.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol?
The IUPAC name of 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol (CID 80859663) is 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol.
What is the SMILES notation for 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol?
The canonical SMILES for 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol is COc1nc(N)nc(OCCO)n1.
What is the InChIKey of 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol?
The InChIKey is UOBQBEGMSORZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O3/c1-12-5-8-4(7)9-6(10-5)13-3-2-11/h11H,2-3H2,1H3,(H2,7,8,9,10).
What are the key properties of 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol?
2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol has a molecular weight of 186.17 g/mol, XLogP of -1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]ethanol is sourced from PubChem (CID 80859663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).