C11H15N3O3 — CID 80861167
6-but-3-enoxy-N-ethyl-5-nitropyridin-2-amine (PubChem CID 80861167) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-but-3-enoxy-N-ethyl-5-nitropyridin-2-amine.
| Compound Name | 6-but-3-enoxy-N-ethyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 80861167 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 6-but-3-enoxy-N-ethyl-5-nitropyridin-2-amine |
| SMILES | C=CCCOc1nc(NCC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O3/c1-3-5-8-17-11-9(14(15)16)6-7-10(13-11)12-4-2/h3,6-7H,1,4-5,8H2,2H3,(H,12,13) |
| InChIKey | UIIHAXKFVBZIQE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|