C14H22N4O — CID 80862180
N-ethyl-8-(4-methylpentoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80862180) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is N-ethyl-8-(4-methylpentoxy)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | N-ethyl-8-(4-methylpentoxy)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80862180 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-ethyl-8-(4-methylpentoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | CCNc1cn2ccnc2c(OCCCC(C)C)n1 |
| InChI | InChI=1S/C14H22N4O/c1-4-15-12-10-18-8-7-16-13(18)14(17-12)19-9-5-6-11(2)3/h7-8,10-11,15H,4-6,9H2,1-3H3 |
| InChIKey | YZFAEHSYURFAIE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|