About 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine
2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine (PubChem CID 80862541) has the molecular formula C11H8Cl3N3O
and a molecular weight of 304.56 g/mol. Its IUPAC name is 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine |
| PubChem CID | 80862541 |
| Molecular Formula | C11H8Cl3N3O |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine |
| SMILES | Cc1nc(N)cc(Oc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H8Cl3N3O/c1-5-16-10(15)4-11(17-5)18-9-3-7(13)6(12)2-8(9)14/h2-4H,1H3,(H2,15,16,17) |
| InChIKey | FELNIKUAXLHAQL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine?
The IUPAC name of 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine (CID 80862541) is 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine.
What is the SMILES notation for 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine?
The canonical SMILES for 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine is Cc1nc(N)cc(Oc2cc(Cl)c(Cl)cc2Cl)n1.
What is the InChIKey of 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine?
The InChIKey is FELNIKUAXLHAQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl3N3O/c1-5-16-10(15)4-11(17-5)18-9-3-7(13)6(12)2-8(9)14/h2-4H,1H3,(H2,15,16,17).
What are the key properties of 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine?
2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine has a molecular weight of 304.56 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(2,4,5-trichlorophenoxy)pyrimidin-4-amine is sourced from PubChem (CID 80862541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).