C11H9F2N3O — CID 80862951
6-(2,4-difluorophenoxy)-N-methylpyrimidin-4-amine (PubChem CID 80862951) has the molecular formula C11H9F2N3O and a molecular weight of 237.21 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-N-methylpyrimidin-4-amine.
| Compound Name | 6-(2,4-difluorophenoxy)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80862951 |
| Molecular Formula | C11H9F2N3O |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(Oc2ccc(F)cc2F)ncn1 |
| InChI | InChI=1S/C11H9F2N3O/c1-14-10-5-11(16-6-15-10)17-9-3-2-7(12)4-8(9)13/h2-6H,1H3,(H,14,15,16) |
| InChIKey | OKXALRPQRJJQHS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |