About 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine
4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine (PubChem CID 80863805) has the molecular formula C14H13FN4OS
and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine |
| PubChem CID | 80863805 |
| Molecular Formula | C14H13FN4OS |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(F)c(Sc2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C14H13FN4OS/c1-2-7-16-13-17-8-9(15)12(19-13)21-14-18-10-5-3-4-6-11(10)20-14/h3-6,8H,2,7H2,1H3,(H,16,17,19) |
| InChIKey | RHYSPNXUPVGETA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine?
The IUPAC name of 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine (CID 80863805) is 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine.
What is the SMILES notation for 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine?
The canonical SMILES for 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine is CCCNc1ncc(F)c(Sc2nc3ccccc3o2)n1.
What is the InChIKey of 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine?
The InChIKey is RHYSPNXUPVGETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN4OS/c1-2-7-16-13-17-8-9(15)12(19-13)21-14-18-10-5-3-4-6-11(10)20-14/h3-6,8H,2,7H2,1H3,(H,16,17,19).
What are the key properties of 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine?
4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine has a molecular weight of 304.35 g/mol, XLogP of 3.73, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-2-ylsulfanyl)-5-fluoro-N-propylpyrimidin-2-amine is sourced from PubChem (CID 80863805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).