C13H15N3O — CID 80863928
6-(2,3-dimethylphenoxy)-5-methylpyrimidin-4-amine (PubChem CID 80863928) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 6-(2,3-dimethylphenoxy)-5-methylpyrimidin-4-amine.
| Compound Name | 6-(2,3-dimethylphenoxy)-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80863928 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 6-(2,3-dimethylphenoxy)-5-methylpyrimidin-4-amine |
| SMILES | Cc1cccc(Oc2ncnc(N)c2C)c1C |
| InChI | InChI=1S/C13H15N3O/c1-8-5-4-6-11(9(8)2)17-13-10(3)12(14)15-7-16-13/h4-7H,1-3H3,(H2,14,15,16) |
| InChIKey | BNOUCPBAXJTMII-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |