C14H17N3O — CID 80864323
6-(3,5-dimethylphenoxy)-2,5-dimethylpyrimidin-4-amine (PubChem CID 80864323) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-(3,5-dimethylphenoxy)-2,5-dimethylpyrimidin-4-amine.
| Compound Name | 6-(3,5-dimethylphenoxy)-2,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80864323 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 6-(3,5-dimethylphenoxy)-2,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1cc(C)cc(Oc2nc(C)nc(N)c2C)c1 |
| InChI | InChI=1S/C14H17N3O/c1-8-5-9(2)7-12(6-8)18-14-10(3)13(15)16-11(4)17-14/h5-7H,1-4H3,(H2,15,16,17) |
| InChIKey | LLDQQCFBIOTLSP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |