C9H14FN3O — CID 80866074
4-butan-2-yloxy-5-fluoro-N-methylpyrimidin-2-amine (PubChem CID 80866074) has the molecular formula C9H14FN3O and a molecular weight of 199.23 g/mol. Its IUPAC name is 4-butan-2-yloxy-5-fluoro-N-methylpyrimidin-2-amine.
| Compound Name | 4-butan-2-yloxy-5-fluoro-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80866074 |
| Molecular Formula | C9H14FN3O |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-butan-2-yloxy-5-fluoro-N-methylpyrimidin-2-amine |
| SMILES | CCC(C)Oc1nc(NC)ncc1F |
| InChI | InChI=1S/C9H14FN3O/c1-4-6(2)14-8-7(10)5-12-9(11-3)13-8/h5-6H,4H2,1-3H3,(H,11,12,13) |
| InChIKey | LXIXBXBEILUCCH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |