C15H17F2N3O — CID 80866182
6-(2,4-difluorophenoxy)-N-ethyl-5-propan-2-ylpyrimidin-4-amine (PubChem CID 80866182) has the molecular formula C15H17F2N3O and a molecular weight of 293.32 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-N-ethyl-5-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-(2,4-difluorophenoxy)-N-ethyl-5-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80866182 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-N-ethyl-5-propan-2-ylpyrimidin-4-amine |
| SMILES | CCNc1ncnc(Oc2ccc(F)cc2F)c1C(C)C |
| InChI | InChI=1S/C15H17F2N3O/c1-4-18-14-13(9(2)3)15(20-8-19-14)21-12-6-5-10(16)7-11(12)17/h5-9H,4H2,1-3H3,(H,18,19,20) |
| InChIKey | ALXDSNSRDTUXSI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |