C10H13BrN6 — CID 80868019
5-bromo-4-(3,5-diethyl-1,2,4-triazol-1-yl)pyrimidin-2-amine (PubChem CID 80868019) has the molecular formula C10H13BrN6 and a molecular weight of 297.16 g/mol. Its IUPAC name is 5-bromo-4-(3,5-diethyl-1,2,4-triazol-1-yl)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-(3,5-diethyl-1,2,4-triazol-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80868019 |
| Molecular Formula | C10H13BrN6 |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 5-bromo-4-(3,5-diethyl-1,2,4-triazol-1-yl)pyrimidin-2-amine |
| SMILES | CCc1nc(CC)n(-c2nc(N)ncc2Br)n1 |
| InChI | InChI=1S/C10H13BrN6/c1-3-7-14-8(4-2)17(16-7)9-6(11)5-13-10(12)15-9/h5H,3-4H2,1-2H3,(H2,12,13,15) |
| InChIKey | XXASIQCTRVTOFC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |