C14H17N3O2 — CID 80869118
6-(2-methoxyphenoxy)-N-propylpyrazin-2-amine (PubChem CID 80869118) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-(2-methoxyphenoxy)-N-propylpyrazin-2-amine.
| Compound Name | 6-(2-methoxyphenoxy)-N-propylpyrazin-2-amine |
|---|---|
| PubChem CID | 80869118 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 6-(2-methoxyphenoxy)-N-propylpyrazin-2-amine |
| SMILES | CCCNc1cncc(Oc2ccccc2OC)n1 |
| InChI | InChI=1S/C14H17N3O2/c1-3-8-16-13-9-15-10-14(17-13)19-12-7-5-4-6-11(12)18-2/h4-7,9-10H,3,8H2,1-2H3,(H,16,17) |
| InChIKey | KXZRVMPSSRWWLO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |