C10H17N5O — CID 80870818
6-(2-pyrrolidin-1-ylethoxy)pyrimidine-2,4-diamine (PubChem CID 80870818) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 6-(2-pyrrolidin-1-ylethoxy)pyrimidine-2,4-diamine.
| Compound Name | 6-(2-pyrrolidin-1-ylethoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80870818 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 6-(2-pyrrolidin-1-ylethoxy)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(OCCN2CCCC2)nc(N)n1 |
| InChI | InChI=1S/C10H17N5O/c11-8-7-9(14-10(12)13-8)16-6-5-15-3-1-2-4-15/h7H,1-6H2,(H4,11,12,13,14) |
| InChIKey | QNQVSXOWIRMUIE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |