C13H23N3O — CID 80871017
6-[3-(dimethylamino)propoxy]-N-propylpyridin-2-amine (PubChem CID 80871017) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propoxy]-N-propylpyridin-2-amine.
| Compound Name | 6-[3-(dimethylamino)propoxy]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 80871017 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 6-[3-(dimethylamino)propoxy]-N-propylpyridin-2-amine |
| SMILES | CCCNc1cccc(OCCCN(C)C)n1 |
| InChI | InChI=1S/C13H23N3O/c1-4-9-14-12-7-5-8-13(15-12)17-11-6-10-16(2)3/h5,7-8H,4,6,9-11H2,1-3H3,(H,14,15) |
| InChIKey | CAAXUUAYXBCRDQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|