C12H21N5O — CID 80871374
6-cycloheptyloxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80871374) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 6-cycloheptyloxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-cycloheptyloxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80871374 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 6-cycloheptyloxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(OC2CCCCCC2)n1 |
| InChI | InChI=1S/C12H21N5O/c1-17(2)11-14-10(13)15-12(16-11)18-9-7-5-3-4-6-8-9/h9H,3-8H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | MQVWSFGAAKFSDF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |