About N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine
N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine (PubChem CID 80871549) has the molecular formula C14H24N4O
and a molecular weight of 264.37 g/mol. Its IUPAC name is N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine |
| PubChem CID | 80871549 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine |
| SMILES | CCNc1nc(C)nc(OCCN2CCCC2)c1C |
| InChI | InChI=1S/C14H24N4O/c1-4-15-13-11(2)14(17-12(3)16-13)19-10-9-18-7-5-6-8-18/h4-10H2,1-3H3,(H,15,16,17) |
| InChIKey | VOXYXCOFCNQZEQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine?
The IUPAC name of N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine (CID 80871549) is N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine.
What is the SMILES notation for N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine?
The canonical SMILES for N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine is CCNc1nc(C)nc(OCCN2CCCC2)c1C.
What is the InChIKey of N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine?
The InChIKey is VOXYXCOFCNQZEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O/c1-4-15-13-11(2)14(17-12(3)16-13)19-10-9-18-7-5-6-8-18/h4-10H2,1-3H3,(H,15,16,17).
What are the key properties of N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine?
N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine has a molecular weight of 264.37 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,5-dimethyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-amine is sourced from PubChem (CID 80871549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).