About [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol
[3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol (PubChem CID 80872480) has the molecular formula C13H12N4O2
and a molecular weight of 256.27 g/mol. Its IUPAC name is [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol.
Molecular Properties
| Compound Name | [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol |
| PubChem CID | 80872480 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol |
| SMILES | Nc1cn2ccnc2c(Oc2cccc(CO)c2)n1 |
| InChI | InChI=1S/C13H12N4O2/c14-11-7-17-5-4-15-12(17)13(16-11)19-10-3-1-2-9(6-10)8-18/h1-7,18H,8,14H2 |
| InChIKey | RJFVPLJRUIUEQQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol?
The IUPAC name of [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol (CID 80872480) is [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol.
What is the SMILES notation for [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol?
The canonical SMILES for [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol is Nc1cn2ccnc2c(Oc2cccc(CO)c2)n1.
What is the InChIKey of [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol?
The InChIKey is RJFVPLJRUIUEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O2/c14-11-7-17-5-4-15-12(17)13(16-11)19-10-3-1-2-9(6-10)8-18/h1-7,18H,8,14H2.
What are the key properties of [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol?
[3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol has a molecular weight of 256.27 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-aminoimidazo[1,2-a]pyrazin-8-yl)oxyphenyl]methanol is sourced from PubChem (CID 80872480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).