C14H17N3O2 — CID 80873590
4-(3-ethoxyphenoxy)-N,6-dimethylpyrimidin-2-amine (PubChem CID 80873590) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-(3-ethoxyphenoxy)-N,6-dimethylpyrimidin-2-amine.
| Compound Name | 4-(3-ethoxyphenoxy)-N,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80873590 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-(3-ethoxyphenoxy)-N,6-dimethylpyrimidin-2-amine |
| SMILES | CCOc1cccc(Oc2cc(C)nc(NC)n2)c1 |
| InChI | InChI=1S/C14H17N3O2/c1-4-18-11-6-5-7-12(9-11)19-13-8-10(2)16-14(15-3)17-13/h5-9H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | BCFKAGCLJDXXMY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |