C12H14N4O4S — CID 80874010
4-ethoxy-6-(4-methylsulfonylphenoxy)-1,3,5-triazin-2-amine (PubChem CID 80874010) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-ethoxy-6-(4-methylsulfonylphenoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-(4-methylsulfonylphenoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80874010 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-ethoxy-6-(4-methylsulfonylphenoxy)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(N)nc(Oc2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C12H14N4O4S/c1-3-19-11-14-10(13)15-12(16-11)20-8-4-6-9(7-5-8)21(2,17)18/h4-7H,3H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | YWOJBQVRQXKBQX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |