C13H14Cl2N4O2 — CID 80874024
4-(3,4-dichlorophenoxy)-N-methyl-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 80874024) has the molecular formula C13H14Cl2N4O2 and a molecular weight of 329.19 g/mol. Its IUPAC name is 4-(3,4-dichlorophenoxy)-N-methyl-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,4-dichlorophenoxy)-N-methyl-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80874024 |
| Molecular Formula | C13H14Cl2N4O2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 4-(3,4-dichlorophenoxy)-N-methyl-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(NC)nc(Oc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H14Cl2N4O2/c1-3-6-20-12-17-11(16-2)18-13(19-12)21-8-4-5-9(14)10(15)7-8/h4-5,7H,3,6H2,1-2H3,(H,16,17,18,19) |
| InChIKey | AUCZYGVWOBAMSQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |