C12H12F2N4O — CID 80874134
6-(3,4-difluorophenoxy)-4-N-ethylpyrimidine-2,4-diamine (PubChem CID 80874134) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is 6-(3,4-difluorophenoxy)-4-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 6-(3,4-difluorophenoxy)-4-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80874134 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 6-(3,4-difluorophenoxy)-4-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCNc1cc(Oc2ccc(F)c(F)c2)nc(N)n1 |
| InChI | InChI=1S/C12H12F2N4O/c1-2-16-10-6-11(18-12(15)17-10)19-7-3-4-8(13)9(14)5-7/h3-6H,2H2,1H3,(H3,15,16,17,18) |
| InChIKey | BDRFXYDTKLBWJD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |