About 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine
8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80874590) has the molecular formula C14H13ClN4O
and a molecular weight of 288.74 g/mol. Its IUPAC name is 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine.
Molecular Properties
| Compound Name | 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine |
| PubChem CID | 80874590 |
| Molecular Formula | C14H13ClN4O |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | Cc1cc(Oc2nc(N)cn3ccnc23)cc(C)c1Cl |
| InChI | InChI=1S/C14H13ClN4O/c1-8-5-10(6-9(2)12(8)15)20-14-13-17-3-4-19(13)7-11(16)18-14/h3-7H,16H2,1-2H3 |
| InChIKey | DIQSDZBIGYIOJT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine?
The IUPAC name of 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine (CID 80874590) is 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine.
What is the SMILES notation for 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine?
The canonical SMILES for 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine is Cc1cc(Oc2nc(N)cn3ccnc23)cc(C)c1Cl.
What is the InChIKey of 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine?
The InChIKey is DIQSDZBIGYIOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN4O/c1-8-5-10(6-9(2)12(8)15)20-14-13-17-3-4-19(13)7-11(16)18-14/h3-7H,16H2,1-2H3.
What are the key properties of 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine?
8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine has a molecular weight of 288.74 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-chloro-3,5-dimethylphenoxy)imidazo[1,2-a]pyrazin-6-amine is sourced from PubChem (CID 80874590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).