C12H12IN3OS — CID 80875276
6-(2-iodophenoxy)-N-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80875276) has the molecular formula C12H12IN3OS and a molecular weight of 373.22 g/mol. Its IUPAC name is 6-(2-iodophenoxy)-N-methyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-(2-iodophenoxy)-N-methyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80875276 |
| Molecular Formula | C12H12IN3OS |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 6-(2-iodophenoxy)-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CNc1cc(Oc2ccccc2I)nc(SC)n1 |
| InChI | InChI=1S/C12H12IN3OS/c1-14-10-7-11(16-12(15-10)18-2)17-9-6-4-3-5-8(9)13/h3-7H,1-2H3,(H,14,15,16) |
| InChIKey | MBALEANSTLOABV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|