C10H9N5O3 — CID 80875321
6-(2-nitrophenoxy)pyrimidine-2,4-diamine (PubChem CID 80875321) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is 6-(2-nitrophenoxy)pyrimidine-2,4-diamine.
| Compound Name | 6-(2-nitrophenoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80875321 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 6-(2-nitrophenoxy)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(Oc2ccccc2[N+](=O)[O-])nc(N)n1 |
| InChI | InChI=1S/C10H9N5O3/c11-8-5-9(14-10(12)13-8)18-7-4-2-1-3-6(7)15(16)17/h1-5H,(H4,11,12,13,14) |
| InChIKey | UWGPEIMYLRDHOF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|