C16H17N3O — CID 80876672
4-[[6-(ethylamino)-2-pyridinyl]oxy]-3,5-dimethylbenzonitrile (PubChem CID 80876672) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[[6-(ethylamino)-2-pyridinyl]oxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[[6-(ethylamino)-2-pyridinyl]oxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 80876672 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-[[6-(ethylamino)-2-pyridinyl]oxy]-3,5-dimethylbenzonitrile |
| SMILES | CCNc1cccc(Oc2c(C)cc(C#N)cc2C)n1 |
| InChI | InChI=1S/C16H17N3O/c1-4-18-14-6-5-7-15(19-14)20-16-11(2)8-13(10-17)9-12(16)3/h5-9H,4H2,1-3H3,(H,18,19) |
| InChIKey | PYFLRLTYPKJFDL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |