C12H18BrN3O2 — CID 80876725
5-bromo-4-(3-methoxycyclohexyl)oxy-N-methylpyrimidin-2-amine (PubChem CID 80876725) has the molecular formula C12H18BrN3O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is 5-bromo-4-(3-methoxycyclohexyl)oxy-N-methylpyrimidin-2-amine.
| Compound Name | 5-bromo-4-(3-methoxycyclohexyl)oxy-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80876725 |
| Molecular Formula | C12H18BrN3O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 5-bromo-4-(3-methoxycyclohexyl)oxy-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(Br)c(OC2CCCC(OC)C2)n1 |
| InChI | InChI=1S/C12H18BrN3O2/c1-14-12-15-7-10(13)11(16-12)18-9-5-3-4-8(6-9)17-2/h7-9H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | KVVIJZKCHVFWJP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |