C11H17N3O2 — CID 80876812
N-ethyl-4-methyl-6-(oxolan-3-yloxy)pyrimidin-2-amine (PubChem CID 80876812) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N-ethyl-4-methyl-6-(oxolan-3-yloxy)pyrimidin-2-amine.
| Compound Name | N-ethyl-4-methyl-6-(oxolan-3-yloxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80876812 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N-ethyl-4-methyl-6-(oxolan-3-yloxy)pyrimidin-2-amine |
| SMILES | CCNc1nc(C)cc(OC2CCOC2)n1 |
| InChI | InChI=1S/C11H17N3O2/c1-3-12-11-13-8(2)6-10(14-11)16-9-4-5-15-7-9/h6,9H,3-5,7H2,1-2H3,(H,12,13,14) |
| InChIKey | WHSCQUHDQNTYGR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |