C12H23N5O2 — CID 80876870
2-N,2-N-diethyl-6-(2-propoxyethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 80876870) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-(2-propoxyethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-6-(2-propoxyethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80876870 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-N,2-N-diethyl-6-(2-propoxyethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCOCCOc1nc(N)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C12H23N5O2/c1-4-7-18-8-9-19-12-15-10(13)14-11(16-12)17(5-2)6-3/h4-9H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | SAWOOEWSIBUQSX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|