About 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine
4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine (PubChem CID 80877207) has the molecular formula C8H11ClN4O
and a molecular weight of 214.66 g/mol. Its IUPAC name is 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine |
| PubChem CID | 80877207 |
| Molecular Formula | C8H11ClN4O |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine |
| SMILES | C=CCCCOc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C8H11ClN4O/c1-2-3-4-5-14-8-12-6(9)11-7(10)13-8/h2H,1,3-5H2,(H2,10,11,12,13) |
| InChIKey | YNUZUNIPLWEOHF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine?
The IUPAC name of 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine (CID 80877207) is 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine?
The canonical SMILES for 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine is C=CCCCOc1nc(N)nc(Cl)n1.
What is the InChIKey of 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine?
The InChIKey is YNUZUNIPLWEOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN4O/c1-2-3-4-5-14-8-12-6(9)11-7(10)13-8/h2H,1,3-5H2,(H2,10,11,12,13).
What are the key properties of 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine?
4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine has a molecular weight of 214.66 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-pent-4-enoxy-1,3,5-triazin-2-amine is sourced from PubChem (CID 80877207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).