C12H9Br2N3O3 — CID 80878170
6-(2,4-dibromophenoxy)-N-methyl-5-nitropyridin-2-amine (PubChem CID 80878170) has the molecular formula C12H9Br2N3O3 and a molecular weight of 403.03 g/mol. Its IUPAC name is 6-(2,4-dibromophenoxy)-N-methyl-5-nitropyridin-2-amine.
| Compound Name | 6-(2,4-dibromophenoxy)-N-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 80878170 |
| Molecular Formula | C12H9Br2N3O3 |
| Molecular Weight | 403.03 g/mol |
| Exact Mass | 400.90 |
| IUPAC Name | 6-(2,4-dibromophenoxy)-N-methyl-5-nitropyridin-2-amine |
| SMILES | CNc1ccc([N+](=O)[O-])c(Oc2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C12H9Br2N3O3/c1-15-11-5-3-9(17(18)19)12(16-11)20-10-4-2-7(13)6-8(10)14/h2-6H,1H3,(H,15,16) |
| InChIKey | CUZFXTRRSWOCGB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.03 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|